C12H15NO — CID 168737750
5-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 168737750) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 5-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 5-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 168737750 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 5-methyl-5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | CC1CCCc2cc(C(N)=O)ccc21 |
| InChI | InChI=1S/C12H15NO/c1-8-3-2-4-9-7-10(12(13)14)5-6-11(8)9/h5-8H,2-4H2,1H3,(H2,13,14) |
| InChIKey | NNOIJKPXOPDWQW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |