C10H12S — CID 176565119
1-methyl-2,3-dihydro-1H-indene-5-thiol (PubChem CID 176565119) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 1-methyl-2,3-dihydro-1H-indene-5-thiol.
| Compound Name | 1-methyl-2,3-dihydro-1H-indene-5-thiol |
|---|---|
| PubChem CID | 176565119 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 1-methyl-2,3-dihydro-1H-indene-5-thiol |
| SMILES | CC1CCc2cc(S)ccc21 |
| InChI | InChI=1S/C10H12S/c1-7-2-3-8-6-9(11)4-5-10(7)8/h4-7,11H,2-3H2,1H3 |
| InChIKey | ZZXDXPRZNQCKFZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|