C25H36 — CID 161247777
methane;1,5,6-trimethyl-2,3-dihydro-1H-indene;2,5,6-trimethyl-2,3-dihydro-1H-indene (PubChem CID 161247777) has the molecular formula C25H36 and a molecular weight of 336.56 g/mol. Its IUPAC name is methane;1,5,6-trimethyl-2,3-dihydro-1H-indene;2,5,6-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | methane;1,5,6-trimethyl-2,3-dihydro-1H-indene;2,5,6-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 161247777 |
| Molecular Formula | C25H36 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | methane;1,5,6-trimethyl-2,3-dihydro-1H-indene;2,5,6-trimethyl-2,3-dihydro-1H-indene |
| SMILES | C.Cc1cc2c(cc1C)C(C)CC2.Cc1cc2c(cc1C)CC(C)C2 |
| InChI | InChI=1S/2C12H16.CH4/c1-8-4-11-6-9(2)10(3)7-12(11)5-8;1-8-4-5-11-6-9(2)10(3)7-12(8)11;/h2*6-8H,4-5H2,1-3H3;1H4 |
| InChIKey | VAWBQCXVGFJXTO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |