C11H14O — CID 86145079
5,6-dimethyl-2,3-dihydro-1H-inden-2-ol (PubChem CID 86145079) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 5,6-dimethyl-2,3-dihydro-1H-inden-2-ol.
| Compound Name | 5,6-dimethyl-2,3-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 86145079 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 5,6-dimethyl-2,3-dihydro-1H-inden-2-ol |
| SMILES | Cc1cc2c(cc1C)CC(O)C2 |
| InChI | InChI=1S/C11H14O/c1-7-3-9-5-11(12)6-10(9)4-8(7)2/h3-4,11-12H,5-6H2,1-2H3 |
| InChIKey | OJYLLWODQRSOCG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |