C23H34N2O — CID 145090879
heptane;6-(6-methoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 145090879) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is heptane;6-(6-methoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | heptane;6-(6-methoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 145090879 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | heptane;6-(6-methoxy-3-pyridinyl)-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CCCCCCC.COc1ccc(-c2ccc3c(c2)CCCN3C)cn1 |
| InChI | InChI=1S/C16H18N2O.C7H16/c1-18-9-3-4-13-10-12(5-7-15(13)18)14-6-8-16(19-2)17-11-14;1-3-5-7-6-4-2/h5-8,10-11H,3-4,9H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | WHGHTVAEHVPTTP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|