C21H23NO2 — CID 110447148
(E)-3-[4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]pent-2-enoic acid (PubChem CID 110447148) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-3-[4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]pent-2-enoic acid.
| Compound Name | (E)-3-[4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 110447148 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-3-[4-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)phenyl]pent-2-enoic acid |
| SMILES | CC/C(=C\C(=O)O)c1ccc(-c2ccc3c(c2)CCCN3C)cc1 |
| InChI | InChI=1S/C21H23NO2/c1-3-15(14-21(23)24)16-6-8-17(9-7-16)18-10-11-20-19(13-18)5-4-12-22(20)2/h6-11,13-14H,3-5,12H2,1-2H3,(H,23,24)/b15-14+ |
| InChIKey | ZALOFNMKNLAVPC-CCEZHUSRSA-N |
| XLogP | 4.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|