C11H12FNO2 — CID 142338422
fluoro 1-methyl-3,4-dihydro-2H-quinoline-6-carboxylate (PubChem CID 142338422) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is fluoro 1-methyl-3,4-dihydro-2H-quinoline-6-carboxylate.
| Compound Name | fluoro 1-methyl-3,4-dihydro-2H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 142338422 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | fluoro 1-methyl-3,4-dihydro-2H-quinoline-6-carboxylate |
| SMILES | CN1CCCc2cc(C(=O)OF)ccc21 |
| InChI | InChI=1S/C11H12FNO2/c1-13-6-2-3-8-7-9(11(14)15-12)4-5-10(8)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | ZMLJWRNTRULQNO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |