C9H12N2 — CID 45079501
1-methyl-3,4-dihydro-2H-1,6-naphthyridine (PubChem CID 45079501) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-methyl-3,4-dihydro-2H-1,6-naphthyridine.
| Compound Name | 1-methyl-3,4-dihydro-2H-1,6-naphthyridine |
|---|---|
| PubChem CID | 45079501 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-methyl-3,4-dihydro-2H-1,6-naphthyridine |
| SMILES | CN1CCCc2cnccc21 |
| InChI | InChI=1S/C9H12N2/c1-11-6-2-3-8-7-10-5-4-9(8)11/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | OWAFGJDEDVTTCN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |