C19H20N2 — CID 62072233
3-ethynyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline (PubChem CID 62072233) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 3-ethynyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline.
| Compound Name | 3-ethynyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline |
|---|---|
| PubChem CID | 62072233 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-ethynyl-N-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]aniline |
| SMILES | C#Cc1cccc(NCc2ccc3c(c2)CCCN3C)c1 |
| InChI | InChI=1S/C19H20N2/c1-3-15-6-4-8-18(13-15)20-14-16-9-10-19-17(12-16)7-5-11-21(19)2/h1,4,6,8-10,12-13,20H,5,7,11,14H2,2H3 |
| InChIKey | XPWIATXCQKHHHK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|