C17H19N3O — CID 62097018
3-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]benzamide (PubChem CID 62097018) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]benzamide.
| Compound Name | 3-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 62097018 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3-[(1-methyl-2,3-dihydroindol-5-yl)methylamino]benzamide |
| SMILES | CN1CCc2cc(CNc3cccc(C(N)=O)c3)ccc21 |
| InChI | InChI=1S/C17H19N3O/c1-20-8-7-13-9-12(5-6-16(13)20)11-19-15-4-2-3-14(10-15)17(18)21/h2-6,9-10,19H,7-8,11H2,1H3,(H2,18,21) |
| InChIKey | JMSVYWLFIZWFRL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |