C9H10N2 — CID 156720618
1-ethenyl-2,3-dihydropyrrolo[2,3-b]pyridine (PubChem CID 156720618) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-ethenyl-2,3-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | 1-ethenyl-2,3-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 156720618 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1-ethenyl-2,3-dihydropyrrolo[2,3-b]pyridine |
| SMILES | C=CN1CCc2cccnc21 |
| InChI | InChI=1S/C9H10N2/c1-2-11-7-5-8-4-3-6-10-9(8)11/h2-4,6H,1,5,7H2 |
| InChIKey | GIUNGCMWYARZDT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |