C16H17BrN2 — CID 114056963
3-[3-(bromomethyl)-2-pyridinyl]-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 114056963) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-[3-(bromomethyl)-2-pyridinyl]-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 3-[3-(bromomethyl)-2-pyridinyl]-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 114056963 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-[3-(bromomethyl)-2-pyridinyl]-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | BrCc1cccnc1N1CCc2ccccc2CC1 |
| InChI | InChI=1S/C16H17BrN2/c17-12-15-6-3-9-18-16(15)19-10-7-13-4-1-2-5-14(13)8-11-19/h1-6,9H,7-8,10-12H2 |
| InChIKey | UBCZQRVVXCKEFW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|