C12H22N2 — CID 143469071
ethane;1-methyl-2,3-dihydropyrrolo[2,3-b]pyridine (PubChem CID 143469071) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is ethane;1-methyl-2,3-dihydropyrrolo[2,3-b]pyridine.
| Compound Name | ethane;1-methyl-2,3-dihydropyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143469071 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | ethane;1-methyl-2,3-dihydropyrrolo[2,3-b]pyridine |
| SMILES | CC.CC.CN1CCc2cccnc21 |
| InChI | InChI=1S/C8H10N2.2C2H6/c1-10-6-4-7-3-2-5-9-8(7)10;2*1-2/h2-3,5H,4,6H2,1H3;2*1-2H3 |
| InChIKey | BAEKOCDLSFTKHB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |