C10H15N3 — CID 127763309
1-ethyl-4-methyl-2,3-dihydropyrido[2,3-b]pyrazine (PubChem CID 127763309) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-ethyl-4-methyl-2,3-dihydropyrido[2,3-b]pyrazine.
| Compound Name | 1-ethyl-4-methyl-2,3-dihydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 127763309 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-ethyl-4-methyl-2,3-dihydropyrido[2,3-b]pyrazine |
| SMILES | CCN1CCN(C)c2ncccc21 |
| InChI | InChI=1S/C10H15N3/c1-3-13-8-7-12(2)10-9(13)5-4-6-11-10/h4-6H,3,7-8H2,1-2H3 |
| InChIKey | URQJAMXXTYQYLB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |