C15H23N3O2 — CID 75393904
ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate (PubChem CID 75393904) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate.
| Compound Name | ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate |
|---|---|
| PubChem CID | 75393904 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate |
| SMILES | CCOC(=O)CCCCN1CCN(C)c2ncccc21 |
| InChI | InChI=1S/C15H23N3O2/c1-3-20-14(19)8-4-5-10-18-12-11-17(2)15-13(18)7-6-9-16-15/h6-7,9H,3-5,8,10-12H2,1-2H3 |
| InChIKey | KGQZPFZNZMCBHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|