About ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate
ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate (PubChem CID 75393904) has the molecular formula C15H23N3O2
and a molecular weight of 277.37 g/mol. Its IUPAC name is ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate.
Molecular Properties
| Compound Name | ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate |
| PubChem CID | 75393904 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate |
| SMILES | CCOC(=O)CCCCN1CCN(C)c2ncccc21 |
| InChI | InChI=1S/C15H23N3O2/c1-3-20-14(19)8-4-5-10-18-12-11-17(2)15-13(18)7-6-9-16-15/h6-7,9H,3-5,8,10-12H2,1-2H3 |
| InChIKey | KGQZPFZNZMCBHW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate?
The IUPAC name of ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate (CID 75393904) is ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate.
What is the SMILES notation for ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate?
The canonical SMILES for ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate is CCOC(=O)CCCCN1CCN(C)c2ncccc21.
What is the InChIKey of ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate?
The InChIKey is KGQZPFZNZMCBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2/c1-3-20-14(19)8-4-5-10-18-12-11-17(2)15-13(18)7-6-9-16-15/h6-7,9H,3-5,8,10-12H2,1-2H3.
What are the key properties of ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate?
ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate has a molecular weight of 277.37 g/mol, XLogP of 2.07, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(4-methyl-2,3-dihydropyrido[2,3-b]pyrazin-1-yl)pentanoate is sourced from PubChem (CID 75393904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).