C12H15N3O2S — CID 79289071
ethyl 4-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)butanoate (PubChem CID 79289071) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is ethyl 4-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)butanoate.
| Compound Name | ethyl 4-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)butanoate |
|---|---|
| PubChem CID | 79289071 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 4-(2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)butanoate |
| SMILES | CCOC(=O)CCCn1c(=S)[nH]c2cccnc21 |
| InChI | InChI=1S/C12H15N3O2S/c1-2-17-10(16)6-4-8-15-11-9(14-12(15)18)5-3-7-13-11/h3,5,7H,2,4,6,8H2,1H3,(H,14,18) |
| InChIKey | SCILCDSPCNUVLX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|