C13H14BrFN2O2S — CID 116737759
ethyl 4-(6-bromo-5-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)butanoate (PubChem CID 116737759) has the molecular formula C13H14BrFN2O2S and a molecular weight of 361.24 g/mol. Its IUPAC name is ethyl 4-(6-bromo-5-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)butanoate.
| Compound Name | ethyl 4-(6-bromo-5-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)butanoate |
|---|---|
| PubChem CID | 116737759 |
| Molecular Formula | C13H14BrFN2O2S |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | ethyl 4-(6-bromo-5-fluoro-2-sulfanylidene-3H-benzimidazol-1-yl)butanoate |
| SMILES | CCOC(=O)CCCn1c(=S)[nH]c2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C13H14BrFN2O2S/c1-2-19-12(18)4-3-5-17-11-6-8(14)9(15)7-10(11)16-13(17)20/h6-7H,2-5H2,1H3,(H,16,20) |
| InChIKey | VHHWUYNPPQLTLC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|