C11H15N3O2S2 — CID 79562446
3-(2-methyl-2-methylsulfonylpropyl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79562446) has the molecular formula C11H15N3O2S2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(2-methyl-2-methylsulfonylpropyl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-(2-methyl-2-methylsulfonylpropyl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79562446 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-(2-methyl-2-methylsulfonylpropyl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | CC(C)(Cn1c(=S)[nH]c2cccnc21)S(C)(=O)=O |
| InChI | InChI=1S/C11H15N3O2S2/c1-11(2,18(3,15)16)7-14-9-8(13-10(14)17)5-4-6-12-9/h4-6H,7H2,1-3H3,(H,13,17) |
| InChIKey | LDMMRDXZPPHSDZ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|