C10H10N4 — CID 96626301
8-methyl-2,3,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene (PubChem CID 96626301) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is 8-methyl-2,3,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene.
| Compound Name | 8-methyl-2,3,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene |
|---|---|
| PubChem CID | 96626301 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 8-methyl-2,3,8,10-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaene |
| SMILES | CN1Cc2ccnn2-c2cccnc21 |
| InChI | InChI=1S/C10H10N4/c1-13-7-8-4-6-12-14(8)9-3-2-5-11-10(9)13/h2-6H,7H2,1H3 |
| InChIKey | IZHZRFZWQUMHMI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |