C10H14N4O — CID 143618555
methanimine;(1-methyl-2H-pyrido[2,3-b]pyrazin-3-yl)methanol (PubChem CID 143618555) has the molecular formula C10H14N4O and a molecular weight of 206.25 g/mol. Its IUPAC name is methanimine;(1-methyl-2H-pyrido[2,3-b]pyrazin-3-yl)methanol.
| Compound Name | methanimine;(1-methyl-2H-pyrido[2,3-b]pyrazin-3-yl)methanol |
|---|---|
| PubChem CID | 143618555 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | methanimine;(1-methyl-2H-pyrido[2,3-b]pyrazin-3-yl)methanol |
| SMILES | CN1CC(CO)=Nc2ncccc21.[H]N=C |
| InChI | InChI=1S/C9H11N3O.CH3N/c1-12-5-7(6-13)11-9-8(12)3-2-4-10-9;1-2/h2-4,13H,5-6H2,1H3;2H,1H2 |
| InChIKey | BGWKXXLPUVVJTQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 72.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|