C9H10N2O — CID 150263417
3,4-dihydro-1,8-naphthyridin-2-ylmethanol (PubChem CID 150263417) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 3,4-dihydro-1,8-naphthyridin-2-ylmethanol.
| Compound Name | 3,4-dihydro-1,8-naphthyridin-2-ylmethanol |
|---|---|
| PubChem CID | 150263417 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3,4-dihydro-1,8-naphthyridin-2-ylmethanol |
| SMILES | OCC1=Nc2ncccc2CC1 |
| InChI | InChI=1S/C9H10N2O/c12-6-8-4-3-7-2-1-5-10-9(7)11-8/h1-2,5,12H,3-4,6H2 |
| InChIKey | GCALHOIOGOXPRL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |