C10H14N2O — CID 14835920
(5,6,7,8-tetrahydroquinolin-7-ylamino)methanol (PubChem CID 14835920) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (5,6,7,8-tetrahydroquinolin-7-ylamino)methanol.
| Compound Name | (5,6,7,8-tetrahydroquinolin-7-ylamino)methanol |
|---|---|
| PubChem CID | 14835920 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (5,6,7,8-tetrahydroquinolin-7-ylamino)methanol |
| SMILES | OCNC1CCc2cccnc2C1 |
| InChI | InChI=1S/C10H14N2O/c13-7-12-9-4-3-8-2-1-5-11-10(8)6-9/h1-2,5,9,12-13H,3-4,6-7H2 |
| InChIKey | LEHUREIPVMDTTD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|