C11H16NP — CID 145086188
6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-8-ylmethylphosphane (PubChem CID 145086188) has the molecular formula C11H16NP and a molecular weight of 193.23 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-8-ylmethylphosphane.
| Compound Name | 6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-8-ylmethylphosphane |
|---|---|
| PubChem CID | 145086188 |
| Molecular Formula | C11H16NP |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-8-ylmethylphosphane |
| SMILES | PCC1CCCc2cccnc2C1 |
| InChI | InChI=1S/C11H16NP/c13-8-9-3-1-4-10-5-2-6-12-11(10)7-9/h2,5-6,9H,1,3-4,7-8,13H2 |
| InChIKey | XLBSCQYJAMZNMC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|