C13H18IN3 — CID 89261198
(Z)-2-N-iodo-1-(5,6,7,8-tetrahydroquinolin-7-yl)but-2-ene-2,3-diamine (PubChem CID 89261198) has the molecular formula C13H18IN3 and a molecular weight of 343.21 g/mol. Its IUPAC name is (Z)-2-N-iodo-1-(5,6,7,8-tetrahydroquinolin-7-yl)but-2-ene-2,3-diamine.
| Compound Name | (Z)-2-N-iodo-1-(5,6,7,8-tetrahydroquinolin-7-yl)but-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 89261198 |
| Molecular Formula | C13H18IN3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (Z)-2-N-iodo-1-(5,6,7,8-tetrahydroquinolin-7-yl)but-2-ene-2,3-diamine |
| SMILES | C/C(N)=C(\CC1CCc2cccnc2C1)NI |
| InChI | InChI=1S/C13H18IN3/c1-9(15)12(17-14)7-10-4-5-11-3-2-6-16-13(11)8-10/h2-3,6,10,17H,4-5,7-8,15H2,1H3/b12-9- |
| InChIKey | NCMYWJJJAAHRMI-XFXZXTDPSA-N |
| XLogP | 2.71 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|