C8H8N2O2 — CID 171934027
1-oxido-3,4-dihydro-1H-1,8-naphthyridin-1-ium-2-one (PubChem CID 171934027) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1-oxido-3,4-dihydro-1H-1,8-naphthyridin-1-ium-2-one.
| Compound Name | 1-oxido-3,4-dihydro-1H-1,8-naphthyridin-1-ium-2-one |
|---|---|
| PubChem CID | 171934027 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 1-oxido-3,4-dihydro-1H-1,8-naphthyridin-1-ium-2-one |
| SMILES | O=C1CCc2cccnc2[NH+]1[O-] |
| InChI | InChI=1S/C8H8N2O2/c11-7-4-3-6-2-1-5-9-8(6)10(7)12/h1-2,5,10H,3-4H2 |
| InChIKey | ASMGSAANNHMIGP-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 57.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |