C9H11N3 — CID 135557765
N-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-imine (PubChem CID 135557765) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is N-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-imine.
| Compound Name | N-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-imine |
|---|---|
| PubChem CID | 135557765 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N-methyl-3,4-dihydro-1H-1,8-naphthyridin-2-imine |
| SMILES | C/N=C1\CCc2cccnc2N1 |
| InChI | InChI=1S/C9H11N3/c1-10-8-5-4-7-3-2-6-11-9(7)12-8/h2-3,6H,4-5H2,1H3,(H,10,11,12) |
| InChIKey | DCHGDBGRMQXTAI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|