C13H12N2 — CID 10330313
9-methyl-5,10-dihydrobenzo[b][1,8]naphthyridine (PubChem CID 10330313) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 9-methyl-5,10-dihydrobenzo[b][1,8]naphthyridine.
| Compound Name | 9-methyl-5,10-dihydrobenzo[b][1,8]naphthyridine |
|---|---|
| PubChem CID | 10330313 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 9-methyl-5,10-dihydrobenzo[b][1,8]naphthyridine |
| SMILES | Cc1cccc2c1Nc1ncccc1C2 |
| InChI | InChI=1S/C13H12N2/c1-9-4-2-5-10-8-11-6-3-7-14-13(11)15-12(9)10/h2-7H,8H2,1H3,(H,14,15) |
| InChIKey | BQMVIPKFQXKTRJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |