C14H16N2O — CID 158350517
1H-pyrimidin-2-one;1,2,3,4-tetrahydronaphthalene (PubChem CID 158350517) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 1H-pyrimidin-2-one;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1H-pyrimidin-2-one;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 158350517 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1H-pyrimidin-2-one;1,2,3,4-tetrahydronaphthalene |
| SMILES | O=c1nccc[nH]1.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C10H12.C4H4N2O/c1-2-6-10-8-4-3-7-9(10)5-1;7-4-5-2-1-3-6-4/h1-2,5-6H,3-4,7-8H2;1-3H,(H,5,6,7) |
| InChIKey | GSGGXHREXIFPQK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |