C7H8N4 — CID 89161769
3-methyl-4H-pyrido[2,3-d]triazine (PubChem CID 89161769) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 3-methyl-4H-pyrido[2,3-d]triazine.
| Compound Name | 3-methyl-4H-pyrido[2,3-d]triazine |
|---|---|
| PubChem CID | 89161769 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 3-methyl-4H-pyrido[2,3-d]triazine |
| SMILES | CN1Cc2cccnc2N=N1 |
| InChI | InChI=1S/C7H8N4/c1-11-5-6-3-2-4-8-7(6)9-10-11/h2-4H,5H2,1H3 |
| InChIKey | JDQSBXDAJQMFFO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |