C10H12N2O — CID 142177840
6,8-dimethyl-5,8-dihydro-1,6-naphthyridin-7-one (PubChem CID 142177840) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 6,8-dimethyl-5,8-dihydro-1,6-naphthyridin-7-one.
| Compound Name | 6,8-dimethyl-5,8-dihydro-1,6-naphthyridin-7-one |
|---|---|
| PubChem CID | 142177840 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 6,8-dimethyl-5,8-dihydro-1,6-naphthyridin-7-one |
| SMILES | CC1C(=O)N(C)Cc2cccnc21 |
| InChI | InChI=1S/C10H12N2O/c1-7-9-8(4-3-5-11-9)6-12(2)10(7)13/h3-5,7H,6H2,1-2H3 |
| InChIKey | WGMFTLZMNNUISC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |