C10H14N2O — CID 162520423
ethane;6-methyl-5H-pyrrolo[3,4-b]pyridin-7-one (PubChem CID 162520423) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is ethane;6-methyl-5H-pyrrolo[3,4-b]pyridin-7-one.
| Compound Name | ethane;6-methyl-5H-pyrrolo[3,4-b]pyridin-7-one |
|---|---|
| PubChem CID | 162520423 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | ethane;6-methyl-5H-pyrrolo[3,4-b]pyridin-7-one |
| SMILES | CC.CN1Cc2cccnc2C1=O |
| InChI | InChI=1S/C8H8N2O.C2H6/c1-10-5-6-3-2-4-9-7(6)8(10)11;1-2/h2-4H,5H2,1H3;1-2H3 |
| InChIKey | ACKOUEZVHWTQKB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |