About methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate
methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate (PubChem CID 68896178) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate.
Molecular Properties
| Compound Name | methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate |
| PubChem CID | 68896178 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate |
| SMILES | COC(=O)C1=C(OC)c2ncccc2CN1C |
| InChI | InChI=1S/C12H14N2O3/c1-14-7-8-5-4-6-13-9(8)11(16-2)10(14)12(15)17-3/h4-6H,7H2,1-3H3 |
| InChIKey | MYMBVORFQATVGO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate?
The IUPAC name of methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate (CID 68896178) is methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate.
What is the SMILES notation for methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate?
The canonical SMILES for methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate is COC(=O)C1=C(OC)c2ncccc2CN1C.
What is the InChIKey of methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate?
The InChIKey is MYMBVORFQATVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-14-7-8-5-4-6-13-9(8)11(16-2)10(14)12(15)17-3/h4-6H,7H2,1-3H3.
What are the key properties of methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate?
methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate has a molecular weight of 234.25 g/mol, XLogP of 1.01, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-methoxy-6-methyl-5H-1,6-naphthyridine-7-carboxylate is sourced from PubChem (CID 68896178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).