About cyclohexane;methyl 2-chloropyridine-3-carboxylate
cyclohexane;methyl 2-chloropyridine-3-carboxylate (PubChem CID 175229380) has the molecular formula C13H18ClNO2
and a molecular weight of 255.74 g/mol. Its IUPAC name is cyclohexane;methyl 2-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | cyclohexane;methyl 2-chloropyridine-3-carboxylate |
| PubChem CID | 175229380 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | cyclohexane;methyl 2-chloropyridine-3-carboxylate |
| SMILES | C1CCCCC1.COC(=O)c1cccnc1Cl |
| InChI | InChI=1S/C7H6ClNO2.C6H12/c1-11-7(10)5-3-2-4-9-6(5)8;1-2-4-6-5-3-1/h2-4H,1H3;1-6H2 |
| InChIKey | HYLBMGIRWMSLGX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze cyclohexane;methyl 2-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;methyl 2-chloropyridine-3-carboxylate?
The IUPAC name of cyclohexane;methyl 2-chloropyridine-3-carboxylate (CID 175229380) is cyclohexane;methyl 2-chloropyridine-3-carboxylate.
What is the SMILES notation for cyclohexane;methyl 2-chloropyridine-3-carboxylate?
The canonical SMILES for cyclohexane;methyl 2-chloropyridine-3-carboxylate is C1CCCCC1.COC(=O)c1cccnc1Cl.
What is the InChIKey of cyclohexane;methyl 2-chloropyridine-3-carboxylate?
The InChIKey is HYLBMGIRWMSLGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO2.C6H12/c1-11-7(10)5-3-2-4-9-6(5)8;1-2-4-6-5-3-1/h2-4H,1H3;1-6H2.
What are the key properties of cyclohexane;methyl 2-chloropyridine-3-carboxylate?
cyclohexane;methyl 2-chloropyridine-3-carboxylate has a molecular weight of 255.74 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;methyl 2-chloropyridine-3-carboxylate is sourced from PubChem (CID 175229380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).