C14H18ClNO2 — CID 64733997
(3,5-dimethylcyclohexyl) 2-chloropyridine-3-carboxylate (PubChem CID 64733997) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl) 2-chloropyridine-3-carboxylate.
| Compound Name | (3,5-dimethylcyclohexyl) 2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 64733997 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (3,5-dimethylcyclohexyl) 2-chloropyridine-3-carboxylate |
| SMILES | CC1CC(C)CC(OC(=O)c2cccnc2Cl)C1 |
| InChI | InChI=1S/C14H18ClNO2/c1-9-6-10(2)8-11(7-9)18-14(17)12-4-3-5-16-13(12)15/h3-5,9-11H,6-8H2,1-2H3 |
| InChIKey | ZZGTZZDHZKHBOG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|