C13H18O3 — CID 849243
[(3S,5R)-3,5-dimethylcyclohexyl] furan-2-carboxylate (PubChem CID 849243) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is [(3S,5R)-3,5-dimethylcyclohexyl] furan-2-carboxylate.
| Compound Name | [(3S,5R)-3,5-dimethylcyclohexyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 849243 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | [(3S,5R)-3,5-dimethylcyclohexyl] furan-2-carboxylate |
| SMILES | C[C@@H]1CC(OC(=O)c2ccco2)C[C@H](C)C1 |
| InChI | InChI=1S/C13H18O3/c1-9-6-10(2)8-11(7-9)16-13(14)12-4-3-5-15-12/h3-5,9-11H,6-8H2,1-2H3/t9-,10+,11? |
| InChIKey | FIKQUSILOYALPR-ZACCUICWSA-N |
| XLogP | 3.26 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |