C13H18O3 — CID 43800878
1-(furan-2-yl)-2-(3-methylcyclohexyl)oxyethanone (PubChem CID 43800878) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(3-methylcyclohexyl)oxyethanone.
| Compound Name | 1-(furan-2-yl)-2-(3-methylcyclohexyl)oxyethanone |
|---|---|
| PubChem CID | 43800878 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 1-(furan-2-yl)-2-(3-methylcyclohexyl)oxyethanone |
| SMILES | CC1CCCC(OCC(=O)c2ccco2)C1 |
| InChI | InChI=1S/C13H18O3/c1-10-4-2-5-11(8-10)16-9-12(14)13-6-3-7-15-13/h3,6-7,10-11H,2,4-5,8-9H2,1H3 |
| InChIKey | ADGWPVCWVDKHOR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |