C16H20O4 — CID 43800920
1-(1,3-benzodioxol-5-yl)-2-(3-methylcyclohexyl)oxyethanone (PubChem CID 43800920) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(3-methylcyclohexyl)oxyethanone.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(3-methylcyclohexyl)oxyethanone |
|---|---|
| PubChem CID | 43800920 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(3-methylcyclohexyl)oxyethanone |
| SMILES | CC1CCCC(OCC(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C16H20O4/c1-11-3-2-4-13(7-11)18-9-14(17)12-5-6-15-16(8-12)20-10-19-15/h5-6,8,11,13H,2-4,7,9-10H2,1H3 |
| InChIKey | UUMIYLXTLVHASZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |