C16H21FO2 — CID 43800867
1-(2-fluorophenyl)-3-(3-methylcyclohexyl)oxypropan-2-one (PubChem CID 43800867) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(3-methylcyclohexyl)oxypropan-2-one.
| Compound Name | 1-(2-fluorophenyl)-3-(3-methylcyclohexyl)oxypropan-2-one |
|---|---|
| PubChem CID | 43800867 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(3-methylcyclohexyl)oxypropan-2-one |
| SMILES | CC1CCCC(OCC(=O)Cc2ccccc2F)C1 |
| InChI | InChI=1S/C16H21FO2/c1-12-5-4-7-15(9-12)19-11-14(18)10-13-6-2-3-8-16(13)17/h2-3,6,8,12,15H,4-5,7,9-11H2,1H3 |
| InChIKey | CZSSBHBUKKMITE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |