C26H18O6 — CID 170936704
[16-(furan-2-carbonyloxy)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl] furan-2-carboxylate (PubChem CID 170936704) has the molecular formula C26H18O6 and a molecular weight of 426.42 g/mol. Its IUPAC name is [16-(furan-2-carbonyloxy)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl] furan-2-carboxylate.
| Compound Name | [16-(furan-2-carbonyloxy)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 170936704 |
| Molecular Formula | C26H18O6 |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | [16-(furan-2-carbonyloxy)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl] furan-2-carboxylate |
| SMILES | O=C(OC1C2c3ccccc3C(c3ccccc32)C1OC(=O)c1ccco1)c1ccco1 |
| InChI | InChI=1S/C26H18O6/c27-25(19-11-5-13-29-19)31-23-21-15-7-1-2-8-16(15)22(18-10-4-3-9-17(18)21)24(23)32-26(28)20-12-6-14-30-20/h1-14,21-24H |
| InChIKey | JHHNCVYJGHAINU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |