C12H15NO3 — CID 3900634
1-azabicyclo[2.2.2]octan-3-yl furan-2-carboxylate (PubChem CID 3900634) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octan-3-yl furan-2-carboxylate.
| Compound Name | 1-azabicyclo[2.2.2]octan-3-yl furan-2-carboxylate |
|---|---|
| PubChem CID | 3900634 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 1-azabicyclo[2.2.2]octan-3-yl furan-2-carboxylate |
| SMILES | O=C(OC1CN2CCC1CC2)c1ccco1 |
| InChI | InChI=1S/C12H15NO3/c14-12(10-2-1-7-15-10)16-11-8-13-5-3-9(11)4-6-13/h1-2,7,9,11H,3-6,8H2 |
| InChIKey | HJIWCIVMJCQGQW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |