C12H12N4 — CID 143141740
3-methyl-1-pyridin-3-yl-2H-imidazo[4,5-b]pyridine (PubChem CID 143141740) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 3-methyl-1-pyridin-3-yl-2H-imidazo[4,5-b]pyridine.
| Compound Name | 3-methyl-1-pyridin-3-yl-2H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 143141740 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-methyl-1-pyridin-3-yl-2H-imidazo[4,5-b]pyridine |
| SMILES | CN1CN(c2cccnc2)c2cccnc21 |
| InChI | InChI=1S/C12H12N4/c1-15-9-16(10-4-2-6-13-8-10)11-5-3-7-14-12(11)15/h2-8H,9H2,1H3 |
| InChIKey | JKUTZSSHRJTIMV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |