C13H13BF4N3- — CID 174642432
3-methyl-1-phenyl-2H-imidazo[4,5-c]pyridine tetrafluoroborate (PubChem CID 174642432) has the molecular formula C13H13BF4N3- and a molecular weight of 298.07 g/mol. Its IUPAC name is 3-methyl-1-phenyl-2H-imidazo[4,5-c]pyridine tetrafluoroborate.
| Compound Name | 3-methyl-1-phenyl-2H-imidazo[4,5-c]pyridine tetrafluoroborate |
|---|---|
| PubChem CID | 174642432 |
| Molecular Formula | C13H13BF4N3- |
| Molecular Weight | 298.07 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3-methyl-1-phenyl-2H-imidazo[4,5-c]pyridine tetrafluoroborate |
| SMILES | CN1CN(c2ccccc2)c2ccncc21.F[B-](F)(F)F |
| InChI | InChI=1S/C13H13N3.BF4/c1-15-10-16(11-5-3-2-4-6-11)12-7-8-14-9-13(12)15;2-1(3,4)5/h2-9H,10H2,1H3;/q;-1 |
| InChIKey | CAWNGHPRGIDMQA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.07 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|