C22H22N4Os — CID 157121404
1-methyl-3-[3-(3-methyl-2H-benzimidazol-1-yl)phenyl]-2H-benzimidazole;osmium (PubChem CID 157121404) has the molecular formula C22H22N4Os and a molecular weight of 532.68 g/mol. Its IUPAC name is 1-methyl-3-[3-(3-methyl-2H-benzimidazol-1-yl)phenyl]-2H-benzimidazole;osmium.
| Compound Name | 1-methyl-3-[3-(3-methyl-2H-benzimidazol-1-yl)phenyl]-2H-benzimidazole;osmium |
|---|---|
| PubChem CID | 157121404 |
| Molecular Formula | C22H22N4Os |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | 1-methyl-3-[3-(3-methyl-2H-benzimidazol-1-yl)phenyl]-2H-benzimidazole;osmium |
| SMILES | CN1CN(c2cccc(N3CN(C)c4ccccc43)c2)c2ccccc21.[Os] |
| InChI | InChI=1S/C22H22N4.Os/c1-23-15-25(21-12-5-3-10-19(21)23)17-8-7-9-18(14-17)26-16-24(2)20-11-4-6-13-22(20)26;/h3-14H,15-16H2,1-2H3; |
| InChIKey | AHZZNMSPGXLOFU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |