C26H36N2 — CID 140790065
1,5,5,6,6,7,7,8,8-nonamethyl-3-phenyl-2H-benzo[f]benzimidazole (PubChem CID 140790065) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 1,5,5,6,6,7,7,8,8-nonamethyl-3-phenyl-2H-benzo[f]benzimidazole.
| Compound Name | 1,5,5,6,6,7,7,8,8-nonamethyl-3-phenyl-2H-benzo[f]benzimidazole |
|---|---|
| PubChem CID | 140790065 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 1,5,5,6,6,7,7,8,8-nonamethyl-3-phenyl-2H-benzo[f]benzimidazole |
| SMILES | CN1CN(c2ccccc2)c2cc3c(cc21)C(C)(C)C(C)(C)C(C)(C)C3(C)C |
| InChI | InChI=1S/C26H36N2/c1-23(2)19-15-21-22(28(17-27(21)9)18-13-11-10-12-14-18)16-20(19)24(3,4)26(7,8)25(23,5)6/h10-16H,17H2,1-9H3 |
| InChIKey | XOJVKXNEMORHGW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |