C48H52N2 — CID 126598362
9-[3-(1,1,2,2,3,3-hexamethylcyclopenta[b]carbazol-9-yl)phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]carbazole (PubChem CID 126598362) has the molecular formula C48H52N2 and a molecular weight of 656.96 g/mol. Its IUPAC name is 9-[3-(1,1,2,2,3,3-hexamethylcyclopenta[b]carbazol-9-yl)phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]carbazole.
| Compound Name | 9-[3-(1,1,2,2,3,3-hexamethylcyclopenta[b]carbazol-9-yl)phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]carbazole |
|---|---|
| PubChem CID | 126598362 |
| Molecular Formula | C48H52N2 |
| Molecular Weight | 656.96 g/mol |
| Exact Mass | 656.41 |
| IUPAC Name | 9-[3-(1,1,2,2,3,3-hexamethylcyclopenta[b]carbazol-9-yl)phenyl]-1,1,2,2,3,3-hexamethylcyclopenta[b]carbazole |
| SMILES | CC1(C)c2cc3c4ccccc4n(-c4cccc(-n5c6ccccc6c6cc7c(cc65)C(C)(C)C(C)(C)C7(C)C)c4)c3cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C48H52N2/c1-43(2)35-25-33-31-20-13-15-22-39(31)49(41(33)27-37(35)45(5,6)47(43,9)10)29-18-17-19-30(24-29)50-40-23-16-14-21-32(40)34-26-36-38(28-42(34)50)46(7,8)48(11,12)44(36,3)4/h13-28H,1-12H3 |
| InChIKey | UIIXYSGPHINYPG-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.96 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |