C60H60N2 — CID 126598816
6-[3-(1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazol-6-yl)phenyl]-1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazole (PubChem CID 126598816) has the molecular formula C60H60N2 and a molecular weight of 809.15 g/mol. Its IUPAC name is 6-[3-(1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazol-6-yl)phenyl]-1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazole.
| Compound Name | 6-[3-(1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazol-6-yl)phenyl]-1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazole |
|---|---|
| PubChem CID | 126598816 |
| Molecular Formula | C60H60N2 |
| Molecular Weight | 809.15 g/mol |
| Exact Mass | 808.48 |
| IUPAC Name | 6-[3-(1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazol-6-yl)phenyl]-1,1,2,2,3,3-hexamethyl-9-phenylcyclopenta[b]carbazole |
| SMILES | CC1(C)c2cc3c4cc(-c5cccc(-c6ccc7c(c6)c6cc8c(cc6n7-c6ccccc6)C(C)(C)C(C)(C)C8(C)C)c5)ccc4n(-c4ccccc4)c3cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C60H60N2/c1-55(2)47-33-45-43-31-39(26-28-51(43)61(41-22-15-13-16-23-41)53(45)35-49(47)57(5,6)59(55,9)10)37-20-19-21-38(30-37)40-27-29-52-44(32-40)46-34-48-50(58(7,8)60(11,12)56(48,3)4)36-54(46)62(52)42-24-17-14-18-25-42/h13-36H,1-12H3 |
| InChIKey | PGEZGWHFPUALBD-UHFFFAOYSA-N |
| XLogP | 16.40 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.15 |
| LogP ≤ 5 | 16.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |