C54H58N2 — CID 146581550
6,6,7,7,8,8,16,16,17,17,18,18-dodecamethyl-2,12-bis(4-phenylphenyl)-2,12-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene (PubChem CID 146581550) has the molecular formula C54H58N2 and a molecular weight of 735.07 g/mol. Its IUPAC name is 6,6,7,7,8,8,16,16,17,17,18,18-dodecamethyl-2,12-bis(4-phenylphenyl)-2,12-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene.
| Compound Name | 6,6,7,7,8,8,16,16,17,17,18,18-dodecamethyl-2,12-bis(4-phenylphenyl)-2,12-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene |
|---|---|
| PubChem CID | 146581550 |
| Molecular Formula | C54H58N2 |
| Molecular Weight | 735.07 g/mol |
| Exact Mass | 734.46 |
| IUPAC Name | 6,6,7,7,8,8,16,16,17,17,18,18-dodecamethyl-2,12-bis(4-phenylphenyl)-2,12-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene |
| SMILES | CC1(C)c2cc3c(cc2C(C)(C)C1(C)C)N(c1ccc(-c2ccccc2)cc1)c1cc2c(cc1N3c1ccc(-c3ccccc3)cc1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C54H58N2/c1-49(2)41-31-45-46(32-42(41)50(3,4)53(49,9)10)56(40-29-25-38(26-30-40)36-21-17-14-18-22-36)48-34-44-43(51(5,6)54(11,12)52(44,7)8)33-47(48)55(45)39-27-23-37(24-28-39)35-19-15-13-16-20-35/h13-34H,1-12H3 |
| InChIKey | PYYNSJCXMGTTIJ-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.07 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |