C51H57NO — CID 126598367
2-(4-dibenzofuran-4-ylphenyl)-6,6,7,7,8,8,12,12,16,16,17,17,18,18-tetradecamethyl-2-azapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene (PubChem CID 126598367) has the molecular formula C51H57NO and a molecular weight of 700.02 g/mol. Its IUPAC name is 2-(4-dibenzofuran-4-ylphenyl)-6,6,7,7,8,8,12,12,16,16,17,17,18,18-tetradecamethyl-2-azapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene.
| Compound Name | 2-(4-dibenzofuran-4-ylphenyl)-6,6,7,7,8,8,12,12,16,16,17,17,18,18-tetradecamethyl-2-azapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene |
|---|---|
| PubChem CID | 126598367 |
| Molecular Formula | C51H57NO |
| Molecular Weight | 700.02 g/mol |
| Exact Mass | 699.44 |
| IUPAC Name | 2-(4-dibenzofuran-4-ylphenyl)-6,6,7,7,8,8,12,12,16,16,17,17,18,18-tetradecamethyl-2-azapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene |
| SMILES | CC1(C)c2cc3c(cc2N(c2ccc(-c4cccc5c4oc4ccccc45)cc2)c2cc4c(cc21)C(C)(C)C(C)(C)C4(C)C)C(C)(C)C(C)(C)C3(C)C |
| InChI | InChI=1S/C51H57NO/c1-45(2)39-26-35-37(48(7,8)50(11,12)46(35,3)4)28-41(39)52(42-29-38-36(27-40(42)45)47(5,6)51(13,14)49(38,9)10)31-24-22-30(23-25-31)32-19-17-20-34-33-18-15-16-21-43(33)53-44(32)34/h15-29H,1-14H3 |
| InChIKey | QKHMCNGDJXPOKP-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.02 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |