C57H46N6O — CID 170567750
2-dibenzofuran-4-yl-4-[1,1,2,2,3,3-hexamethyl-6-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]inden-5-yl]-6-phenyl-1,3,5-triazine (PubChem CID 170567750) has the molecular formula C57H46N6O and a molecular weight of 831.04 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-4-[1,1,2,2,3,3-hexamethyl-6-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]inden-5-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-4-yl-4-[1,1,2,2,3,3-hexamethyl-6-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]inden-5-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 170567750 |
| Molecular Formula | C57H46N6O |
| Molecular Weight | 831.04 g/mol |
| Exact Mass | 830.37 |
| IUPAC Name | 2-dibenzofuran-4-yl-4-[1,1,2,2,3,3-hexamethyl-6-[4-phenyl-6-(3-phenylphenyl)-1,3,5-triazin-2-yl]inden-5-yl]-6-phenyl-1,3,5-triazine |
| SMILES | CC1(C)c2cc(-c3nc(-c4ccccc4)nc(-c4cccc(-c5ccccc5)c4)n3)c(-c3nc(-c4ccccc4)nc(-c4cccc5c4oc4ccccc45)n3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C57H46N6O/c1-55(2)45-33-43(53-60-49(36-22-12-8-13-23-36)58-51(62-53)39-27-18-26-38(32-39)35-20-10-7-11-21-35)44(34-46(45)56(3,4)57(55,5)6)54-61-50(37-24-14-9-15-25-37)59-52(63-54)42-30-19-29-41-40-28-16-17-31-47(40)64-48(41)42/h7-34H,1-6H3 |
| InChIKey | CHDVIMDCJMCKTN-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.04 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |