C39H35NO — CID 126598409
6-(4-dibenzofuran-4-ylphenyl)-1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]carbazole (PubChem CID 126598409) has the molecular formula C39H35NO and a molecular weight of 533.72 g/mol. Its IUPAC name is 6-(4-dibenzofuran-4-ylphenyl)-1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]carbazole.
| Compound Name | 6-(4-dibenzofuran-4-ylphenyl)-1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]carbazole |
|---|---|
| PubChem CID | 126598409 |
| Molecular Formula | C39H35NO |
| Molecular Weight | 533.72 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 6-(4-dibenzofuran-4-ylphenyl)-1,1,2,2,3,3-hexamethyl-9H-cyclopenta[b]carbazole |
| SMILES | CC1(C)c2cc3[nH]c4ccc(-c5ccc(-c6cccc7c6oc6ccccc67)cc5)cc4c3cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C39H35NO/c1-37(2)31-21-30-29-20-25(18-19-33(29)40-34(30)22-32(31)38(3,4)39(37,5)6)23-14-16-24(17-15-23)26-11-9-12-28-27-10-7-8-13-35(27)41-36(26)28/h7-22,40H,1-6H3 |
| InChIKey | IAWHJFVBPUSXRK-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.72 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |